CAS 1023531-95-4 is the registry number for 4-(4-fluorophenyl)piperazinyl phenylcyclopentyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
[4-(4-fluorophenyl)piperazin-1-yl]-(1-phenylcyclopentyl)methanone (CAS 1023531-95-4) is a chemical compound with the molecular formula C22H25FN2O and a molecular weight of 352.4 g/mol. IUPAC name: [4-(4-fluorophenyl)piperazin-1-yl]-(1-phenylcyclopentyl)methanone. InChIKey: BVGPFYXKKVCYOH-UHFFFAOYSA-N.
| Molecular formula | C22H25FN2O |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | [4-(4-fluorophenyl)piperazin-1-yl]-(1-phenylcyclopentyl)methanone |
| InChIKey | BVGPFYXKKVCYOH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)N3CCN(CC3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)