CAS 1023532-89-9 is the registry number for 2-(((2-chloro-5-nitrophenyl)amino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2-chloro-5-nitrophenyl)iminomethyl]-3-hydroxyinden-1-one (CAS 1023532-89-9) is a chemical compound with the molecular formula C16H9ClN2O4 and a molecular weight of 328.70 g/mol. IUPAC name: 2-[(2-chloro-5-nitrophenyl)iminomethyl]-3-hydroxyinden-1-one. InChIKey: SRQCNFCQJFRVNA-UHFFFAOYSA-N.
| Molecular formula | C16H9ClN2O4 |
|---|---|
| Molecular weight | 328.70 g/mol |
| IUPAC name | 2-[(2-chloro-5-nitrophenyl)iminomethyl]-3-hydroxyinden-1-one |
| InChIKey | SRQCNFCQJFRVNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C2=O)C=NC3=C(C=CC(=C3)[N+](=O)[O-])Cl)O |
Computed by PubChem (NCBI)