CAS 1023540-07-9 is the registry number for 2-((5-nitro-2-(2-pyridylthio)phenyl)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(5-nitro-2-pyridin-2-ylsulfanylphenyl)methylidene]indene-1,3-dione (CAS 1023540-07-9) is a chemical compound with the molecular formula C21H12N2O4S and a molecular weight of 388.4 g/mol. IUPAC name: 2-[(5-nitro-2-pyridin-2-ylsulfanylphenyl)methylidene]indene-1,3-dione. InChIKey: UKAWGRNMGLZNRR-UHFFFAOYSA-N.
| Molecular formula | C21H12N2O4S |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 2-[(5-nitro-2-pyridin-2-ylsulfanylphenyl)methylidene]indene-1,3-dione |
| InChIKey | UKAWGRNMGLZNRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CC3=C(C=CC(=C3)[N+](=O)[O-])SC4=CC=CC=N4)C2=O |
Computed by PubChem (NCBI)