CAS 1023568-82-2 is the registry number for 2-((4-chlorophenyl)sulfonyl)-N-(((phenylamino)thioxomethyl)amino)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-[[2-(4-chlorophenyl)sulfonylacetyl]amino]-3-phenylthiourea (CAS 1023568-82-2) is a chemical compound with the molecular formula C15H14ClN3O3S2 and a molecular weight of 383.9 g/mol. IUPAC name: 1-[[2-(4-chlorophenyl)sulfonylacetyl]amino]-3-phenylthiourea. InChIKey: DUBZLZQFOBANMK-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O3S2 |
|---|---|
| Molecular weight | 383.9 g/mol |
| IUPAC name | 1-[[2-(4-chlorophenyl)sulfonylacetyl]amino]-3-phenylthiourea |
| InChIKey | DUBZLZQFOBANMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=S)NNC(=O)CS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)