CAS 1023594-49-1 appears in our catalog under these names: Palbociclib Impurity F, Palbociclib Impurity 68, tert-Butyl 4-(2-aminopyridin-3-yl)piperazine-1-carboxylate, 98%, tert-Butyl 4-(2-aminopyridin-3-yl)piperazine-1-carboxylate. Offered by: Chemat Brand, AmBeed, Biosynth. Available pack sizes: on request, 5g, 0,05g, 0,25g, 0,1g, 0,5g, 1g.
Tert-butyl 4-(2-amino-3-pyridinyl)piperazine-1-carboxylate (CAS 1023594-49-1) is a chemical compound with the molecular formula C14H22N4O2 and a molecular weight of 278.35 g/mol. IUPAC name: tert-butyl 4-(2-amino-3-pyridinyl)piperazine-1-carboxylate. InChIKey: HISOLHQGXPBGOI-UHFFFAOYSA-N.
| Molecular formula | C14H22N4O2 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | tert-butyl 4-(2-amino-3-pyridinyl)piperazine-1-carboxylate |
| InChIKey | HISOLHQGXPBGOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(N=CC=C2)N |
Computed by PubChem (NCBI)