Products 1023595-18-7

CAS 1023595-18-7 appears in our catalog under these names: (2-Cyanothiophen-3-yl)boronic acid, 95%, (2-Cyanothiophen-3-yl)boronic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

(2-cyanothiophen-3-yl)boronic acid (CAS 1023595-18-7) is a chemical compound with the molecular formula C5H4BNO2S and a molecular weight of 152.97 g/mol. IUPAC name: (2-cyanothiophen-3-yl)boronic acid. InChIKey: RFWCHPVGCQCEQB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BNO2S
Molecular weight152.97 g/mol
IUPAC name(2-cyanothiophen-3-yl)boronic acid
InChIKeyRFWCHPVGCQCEQB-UHFFFAOYSA-N
SMILESB(C1=C(SC=C1)C#N)(O)O

Computed by PubChem (NCBI)