Products 1023650-66-9
CAS 1023650-66-9 appears in our catalog under these names: PF–3882845, PF-03882845, PF-3882845, 99.63% ,, 99.63% ,, PF-3882845, 99.90%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 50mg, 1mg, 10mg, 25mg, 1 mg, 10 mg, 5 mg.
(3S,3aR)-2-(3-chloro-4-cyanophenyl)-3-cyclopentyl-3,3a,4,5-tetrahydrobenzo[g]indazole-7-carboxylic acid (CAS 1023650-66-9) is a chemical compound with the molecular formula C24H22ClN3O2 and a molecular weight of 419.9 g/mol. IUPAC name: (3S,3aR)-2-(3-chloro-4-cyanophenyl)-3-cyclopentyl-3,3a,4,5-tetrahydrobenzo[g]indazole-7-carboxylic acid. InChIKey: XNULRSOGWPFPBL-REWPJTCUSA-N.
| Molecular formula | C24H22ClN3O2 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | (3S,3aR)-2-(3-chloro-4-cyanophenyl)-3-cyclopentyl-3,3a,4,5-tetrahydrobenzo[g]indazole-7-carboxylic acid |
| InChIKey | XNULRSOGWPFPBL-REWPJTCUSA-N |
| SMILES | C1CCC(C1)[C@H]2[C@H]3CCC4=C(C3=NN2C5=CC(=C(C=C5)C#N)Cl)C=CC(=C4)C(=O)O |
Computed by PubChem (NCBI)