Products 1023818-09-8
CAS 1023818-09-8 is the registry number for 6-(2,6-Dimethylmorpholino)-2-methylpyrimidin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(2,6-dimethylmorpholin-4-yl)-2-methylpyrimidin-4-amine (CAS 1023818-09-8) is a chemical compound with the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. IUPAC name: 6-(2,6-dimethylmorpholin-4-yl)-2-methylpyrimidin-4-amine. InChIKey: GEXGKRKNVSWLOG-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O |
|---|---|
| Molecular weight | 222.29 g/mol |
| IUPAC name | 6-(2,6-dimethylmorpholin-4-yl)-2-methylpyrimidin-4-amine |
| InChIKey | GEXGKRKNVSWLOG-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=NC(=NC(=C2)N)C |
Computed by PubChem (NCBI)