CAS 1023875-03-7 is the registry number for ((4-chloro-2-nitrophenyl)sulfonyl)(2-piperidylethyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
4-chloro-2-nitro-N-(2-piperidin-1-ylethyl)benzenesulfonamide (CAS 1023875-03-7) is a chemical compound with the molecular formula C13H18ClN3O4S and a molecular weight of 347.82 g/mol. IUPAC name: 4-chloro-2-nitro-N-(2-piperidin-1-ylethyl)benzenesulfonamide. InChIKey: RJHDYDGBPVGJHA-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN3O4S |
|---|---|
| Molecular weight | 347.82 g/mol |
| IUPAC name | 4-chloro-2-nitro-N-(2-piperidin-1-ylethyl)benzenesulfonamide |
| InChIKey | RJHDYDGBPVGJHA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCNS(=O)(=O)C2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)