CAS 102391-07-1 appears in our catalog under these names: Amodiaquine N-Oxide , Amodiaquine N-Oxide. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
N-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]-N-ethylethanamine oxide (CAS 102391-07-1) is a chemical compound with the molecular formula C20H22ClN3O2 and a molecular weight of 371.9 g/mol. IUPAC name: N-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]-N-ethylethanamine oxide. InChIKey: AUGSHLRPGOSTAD-UHFFFAOYSA-N.
| Molecular formula | C20H22ClN3O2 |
|---|---|
| Molecular weight | 371.9 g/mol |
| IUPAC name | N-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]-N-ethylethanamine oxide |
| InChIKey | AUGSHLRPGOSTAD-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC1=C(C=CC(=C1)NC2=C3C=CC(=CC3=NC=C2)Cl)O)[O-] |
Computed by PubChem (NCBI)