CAS 1024058-35-2 appears in our catalog under these names: 4,5,6,7-Tetrahydrobenzo(d)thiazole-2-carboxylic acid, 97%, OTAVA-BB 1368280, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
4,5,6,7-tetrahydro-1,3-benzothiazole-2-carboxylic acid (CAS 1024058-35-2) is a chemical compound with the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1,3-benzothiazole-2-carboxylic acid. InChIKey: URJVHPYSDFTUKA-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2S |
|---|---|
| Molecular weight | 183.23 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | URJVHPYSDFTUKA-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)N=C(S2)C(=O)O |
Computed by PubChem (NCBI)