Products 1024135-49-6
CAS 1024135-49-6 is the registry number for N-((3-bromophenyl)methyl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[(3-bromophenyl)methyl]-1-phenylcyclopentane-1-carboxamide (CAS 1024135-49-6) is a chemical compound with the molecular formula C19H20BrNO and a molecular weight of 358.3 g/mol. IUPAC name: N-[(3-bromophenyl)methyl]-1-phenylcyclopentane-1-carboxamide. InChIKey: SXTQZZFBAPILPX-UHFFFAOYSA-N.
| Molecular formula | C19H20BrNO |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | N-[(3-bromophenyl)methyl]-1-phenylcyclopentane-1-carboxamide |
| InChIKey | SXTQZZFBAPILPX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NCC3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)