CAS 1024146-91-5 is the registry number for 2-benzo(d)1,3-dioxolen-5-yl-3-((3-methylphenyl)amino)inden-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-(1,3-benzodioxol-5-yl)-3-(3-methylanilino)inden-1-one (CAS 1024146-91-5) is a chemical compound with the molecular formula C23H17NO3 and a molecular weight of 355.4 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-3-(3-methylanilino)inden-1-one. InChIKey: RYBOVCZCTBHABG-UHFFFAOYSA-N.
| Molecular formula | C23H17NO3 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-3-(3-methylanilino)inden-1-one |
| InChIKey | RYBOVCZCTBHABG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC2=C(C(=O)C3=CC=CC=C32)C4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)