CAS 1024151-61-8 is the registry number for 2-((3-chloro-4-methoxyphenyl)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(3-chloro-4-methoxyphenyl)methylidene]indene-1,3-dione (CAS 1024151-61-8) is a chemical compound with the molecular formula C17H11ClO3 and a molecular weight of 298.7 g/mol. IUPAC name: 2-[(3-chloro-4-methoxyphenyl)methylidene]indene-1,3-dione. InChIKey: RRJYTVIIWVEXRH-UHFFFAOYSA-N.
| Molecular formula | C17H11ClO3 |
|---|---|
| Molecular weight | 298.7 g/mol |
| IUPAC name | 2-[(3-chloro-4-methoxyphenyl)methylidene]indene-1,3-dione |
| InChIKey | RRJYTVIIWVEXRH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=C2C(=O)C3=CC=CC=C3C2=O)Cl |
Computed by PubChem (NCBI)