Products 1024168-17-9
CAS 1024168-17-9 is the registry number for N-(5-tert-butyl-1,2-oxazol-3-yl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(5-tert-butyl-1,2-oxazol-3-yl)-1-phenylcyclopentane-1-carboxamide (CAS 1024168-17-9) is a chemical compound with the molecular formula C19H24N2O2 and a molecular weight of 312.4 g/mol. IUPAC name: N-(5-tert-butyl-1,2-oxazol-3-yl)-1-phenylcyclopentane-1-carboxamide. InChIKey: ZTFAHGMSDXDHIV-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | N-(5-tert-butyl-1,2-oxazol-3-yl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | ZTFAHGMSDXDHIV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NO1)NC(=O)C2(CCCC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)