CAS 102417-94-7 appears in our catalog under these names: Dansylamino-pitc, 95%, 4-(N-1-Dimethylaminonaphthalene-5-sulfonylamino)phenyl Isothiocyanate, Dansylamino–PITC (Fluorescent Coupling Reagent for Edman Degradation), Dansylamino-PITC [Fluorescent Coupling Reagent for Edman Degradation], >98.0%(HPLC)(N), Dansylamino-pitc. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 100mg, 10mg, 25mg.
5-(dimethylamino)-N-(4-isothiocyanatophenyl)naphthalene-1-sulfonamide (CAS 102417-94-7) is a chemical compound with the molecular formula C19H17N3O2S2 and a molecular weight of 383.5 g/mol. IUPAC name: 5-(dimethylamino)-N-(4-isothiocyanatophenyl)naphthalene-1-sulfonamide. InChIKey: MZGXHCHKGRQLHR-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O2S2 |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 5-(dimethylamino)-N-(4-isothiocyanatophenyl)naphthalene-1-sulfonamide |
| InChIKey | MZGXHCHKGRQLHR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)NC3=CC=C(C=C3)N=C=S |
Computed by PubChem (NCBI)