CAS 1024174-11-5 is the registry number for 2-Thienyl-N-((3-(trifluoromethoxy)phenyl)methyl)formamide. Offered by: Biosynth. Available pack sizes: 25g, 10g.
N-[[3-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide (CAS 1024174-11-5) is a chemical compound with the molecular formula C13H10F3NO2S and a molecular weight of 301.29 g/mol. IUPAC name: N-[[3-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide. InChIKey: KNYYSYLXYZHPLX-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO2S |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | N-[[3-(trifluoromethoxy)phenyl]methyl]thiophene-2-carboxamide |
| InChIKey | KNYYSYLXYZHPLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)CNC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)