Products 10242-15-6

CAS 10242-15-6 is the registry number for 6-Nitro-2-oxochromene-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6-nitro-2-oxochromene-3-carboxylic acid (CAS 10242-15-6) is a chemical compound with the molecular formula C10H5NO6 and a molecular weight of 235.15 g/mol. IUPAC name: 6-nitro-2-oxochromene-3-carboxylic acid. InChIKey: VZOCWMKJXRWWFI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5NO6
Molecular weight235.15 g/mol
IUPAC name6-nitro-2-oxochromene-3-carboxylic acid
InChIKeyVZOCWMKJXRWWFI-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1[N+](=O)[O-])C=C(C(=O)O2)C(=O)O

Computed by PubChem (NCBI)