CAS 10242-15-6 is the registry number for 6-Nitro-2-oxochromene-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-nitro-2-oxochromene-3-carboxylic acid (CAS 10242-15-6) is a chemical compound with the molecular formula C10H5NO6 and a molecular weight of 235.15 g/mol. IUPAC name: 6-nitro-2-oxochromene-3-carboxylic acid. InChIKey: VZOCWMKJXRWWFI-UHFFFAOYSA-N.
| Molecular formula | C10H5NO6 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 6-nitro-2-oxochromene-3-carboxylic acid |
| InChIKey | VZOCWMKJXRWWFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=C(C(=O)O2)C(=O)O |
Computed by PubChem (NCBI)