CAS 1024222-55-6 is the registry number for 2-methyl-8-(5-(trifluoromethyl)(2-pyridyloxy))quinoline. Offered by: Biosynth. Available pack sizes: 250mg.
2-methyl-8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline (CAS 1024222-55-6) is a chemical compound with the molecular formula C16H11F3N2O and a molecular weight of 304.27 g/mol. IUPAC name: 2-methyl-8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline. InChIKey: UCOJQTLQCYLIGN-UHFFFAOYSA-N.
| Molecular formula | C16H11F3N2O |
|---|---|
| Molecular weight | 304.27 g/mol |
| IUPAC name | 2-methyl-8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinoline |
| InChIKey | UCOJQTLQCYLIGN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=C2OC3=NC=C(C=C3)C(F)(F)F)C=C1 |
Computed by PubChem (NCBI)