CAS 1024267-23-9 is the registry number for 5-Chloronaphthalene-2-sulfonic Acid, Potassium Salt. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
Potassium 5-chloronaphthalene-2-sulfonate (CAS 1024267-23-9) is a chemical compound with the molecular formula C10H6ClKO3S and a molecular weight of 280.77 g/mol. IUPAC name: potassium 5-chloronaphthalene-2-sulfonate. InChIKey: ISLSQNBMQRBRPH-UHFFFAOYSA-M.
| Molecular formula | C10H6ClKO3S |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | potassium 5-chloronaphthalene-2-sulfonate |
| InChIKey | ISLSQNBMQRBRPH-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C=CC(=C2)S(=O)(=O)[O-])C(=C1)Cl.[K+] |
Computed by PubChem (NCBI)