Products 1024287-63-5
CAS 1024287-63-5 is the registry number for (aminomethylamino)((2,2,7-trimethyl(3-oxaindan-4-yl))amino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
1-amino-1-methyl-3-(2,2,4-trimethyl-3H-1-benzofuran-7-yl)thiourea (CAS 1024287-63-5) is a chemical compound with the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. IUPAC name: 1-amino-1-methyl-3-(2,2,4-trimethyl-3H-1-benzofuran-7-yl)thiourea. InChIKey: WIXSMOXZXOUMTF-UHFFFAOYSA-N.
| Molecular formula | C13H19N3OS |
|---|---|
| Molecular weight | 265.38 g/mol |
| IUPAC name | 1-amino-1-methyl-3-(2,2,4-trimethyl-3H-1-benzofuran-7-yl)thiourea |
| InChIKey | WIXSMOXZXOUMTF-UHFFFAOYSA-N |
| SMILES | CC1=C2CC(OC2=C(C=C1)NC(=S)N(C)N)(C)C |
Computed by PubChem (NCBI)