Products 1024364-57-5
CAS 1024364-57-5 is the registry number for Tyrosinase-IN-20. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 3,7-dimethyl-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (CAS 1024364-57-5) is a chemical compound with the molecular formula C17H18N2O2S and a molecular weight of 314.4 g/mol. IUPAC name: ethyl 3,7-dimethyl-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate. InChIKey: XQBBRDUZCXRARK-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O2S |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | ethyl 3,7-dimethyl-5-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| InChIKey | XQBBRDUZCXRARK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2N(C1C3=CC=CC=C3)C(=CS2)C)C |
Computed by PubChem (NCBI)