CAS 1024367-69-8 is the registry number for 3-Chloro-2-(2-methyl(8-quinolyloxy))-5-(trifluoromethyl)pyridine. Offered by: Biosynth. Available pack sizes: 5000mg.
8-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methylquinoline (CAS 1024367-69-8) is a chemical compound with the molecular formula C16H10ClF3N2O and a molecular weight of 338.71 g/mol. IUPAC name: 8-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methylquinoline. InChIKey: OICLAXMNSFOECT-UHFFFAOYSA-N.
| Molecular formula | C16H10ClF3N2O |
|---|---|
| Molecular weight | 338.71 g/mol |
| IUPAC name | 8-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2-methylquinoline |
| InChIKey | OICLAXMNSFOECT-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=C2OC3=C(C=C(C=N3)C(F)(F)F)Cl)C=C1 |
Computed by PubChem (NCBI)