Products 1024453-68-6
CAS 1024453-68-6 is the registry number for 2-((2,5-thiazolylamino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
3-hydroxy-2-[(E)-1,3-thiazol-2-yliminomethyl]inden-1-one (CAS 1024453-68-6) is a chemical compound with the molecular formula C13H8N2O2S and a molecular weight of 256.28 g/mol. IUPAC name: 3-hydroxy-2-[(E)-1,3-thiazol-2-yliminomethyl]inden-1-one. InChIKey: JUSXWIIUUZHKIN-VIZOYTHASA-N.
| Molecular formula | C13H8N2O2S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 3-hydroxy-2-[(E)-1,3-thiazol-2-yliminomethyl]inden-1-one |
| InChIKey | JUSXWIIUUZHKIN-VIZOYTHASA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C2=O)/C=N/C3=NC=CS3)O |
Computed by PubChem (NCBI)