Products 1024477-95-9
CAS 1024477-95-9 is the registry number for N-(((4-chlorophenyl)amino)carbonylamino)-2-indol-3-ylethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-chlorophenyl)-3-[[2-(1H-indol-3-yl)acetyl]amino]urea (CAS 1024477-95-9) is a chemical compound with the molecular formula C17H15ClN4O2 and a molecular weight of 342.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-[[2-(1H-indol-3-yl)acetyl]amino]urea. InChIKey: INHIAAQQTVCDBG-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN4O2 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-[[2-(1H-indol-3-yl)acetyl]amino]urea |
| InChIKey | INHIAAQQTVCDBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)NNC(=O)NC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)