CAS 1024497-93-5 is the registry number for 4-chloro-N-cyclopropyl-2-nitrobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-chloro-N-cyclopropyl-2-nitrobenzenesulfonamide (CAS 1024497-93-5) is a chemical compound with the molecular formula C9H9ClN2O4S and a molecular weight of 276.70 g/mol. IUPAC name: 4-chloro-N-cyclopropyl-2-nitrobenzenesulfonamide. InChIKey: DSYSCGDVEQXZJR-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O4S |
|---|---|
| Molecular weight | 276.70 g/mol |
| IUPAC name | 4-chloro-N-cyclopropyl-2-nitrobenzenesulfonamide |
| InChIKey | DSYSCGDVEQXZJR-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)