CAS 1024504-66-2 is the registry number for N-(2,3-dimethyl-5-oxo-1-phenyl(3-pyrazolin-4-yl))(3,4,5-triiodophenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3,4,5-triiodobenzamide (CAS 1024504-66-2) is a chemical compound with the molecular formula C18H14I3N3O2 and a molecular weight of 685.0 g/mol. IUPAC name: N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3,4,5-triiodobenzamide. InChIKey: QTQITJLMGVQZOC-UHFFFAOYSA-N.
| Molecular formula | C18H14I3N3O2 |
|---|---|
| Molecular weight | 685.0 g/mol |
| IUPAC name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3,4,5-triiodobenzamide |
| InChIKey | QTQITJLMGVQZOC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC(=O)C3=CC(=C(C(=C3)I)I)I |
Computed by PubChem (NCBI)