CAS 1024523-16-7 is the registry number for 1-(4-chlorobenzoyl)-3-(4-((isopropyl)phenylamino)phenyl)thiourea. Offered by: Biosynth. Available pack sizes: 250mg.
4-chloro-N-[[4-(N-propan-2-ylanilino)phenyl]carbamothioyl]benzamide (CAS 1024523-16-7) is a chemical compound with the molecular formula C23H22ClN3OS and a molecular weight of 424.0 g/mol. IUPAC name: 4-chloro-N-[[4-(N-propan-2-ylanilino)phenyl]carbamothioyl]benzamide. InChIKey: YLPMTRHXNXAINZ-UHFFFAOYSA-N.
| Molecular formula | C23H22ClN3OS |
|---|---|
| Molecular weight | 424.0 g/mol |
| IUPAC name | 4-chloro-N-[[4-(N-propan-2-ylanilino)phenyl]carbamothioyl]benzamide |
| InChIKey | YLPMTRHXNXAINZ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=CC=CC=C1)C2=CC=C(C=C2)NC(=S)NC(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)