CAS 1024572-87-9 is the registry number for methyl 2-((((2-chloro-5-nitrophenyl)amino)thioxomethyl)amino)thiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl 2-[(2-chloro-5-nitrophenyl)carbamothioylamino]thiophene-3-carboxylate (CAS 1024572-87-9) is a chemical compound with the molecular formula C13H10ClN3O4S2 and a molecular weight of 371.8 g/mol. IUPAC name: methyl 2-[(2-chloro-5-nitrophenyl)carbamothioylamino]thiophene-3-carboxylate. InChIKey: ARQKZIAMZHIRAS-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O4S2 |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | methyl 2-[(2-chloro-5-nitrophenyl)carbamothioylamino]thiophene-3-carboxylate |
| InChIKey | ARQKZIAMZHIRAS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC=C1)NC(=S)NC2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)