CAS 1024574-56-8 is the registry number for N-(2,6-bis(propan-2-yl)phenyl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[2,6-di(propan-2-yl)phenyl]-1-phenylcyclopentane-1-carboxamide (CAS 1024574-56-8) is a chemical compound with the molecular formula C24H31NO and a molecular weight of 349.5 g/mol. IUPAC name: N-[2,6-di(propan-2-yl)phenyl]-1-phenylcyclopentane-1-carboxamide. InChIKey: RZXAUCOYYYUCJS-UHFFFAOYSA-N.
| Molecular formula | C24H31NO |
|---|---|
| Molecular weight | 349.5 g/mol |
| IUPAC name | N-[2,6-di(propan-2-yl)phenyl]-1-phenylcyclopentane-1-carboxamide |
| InChIKey | RZXAUCOYYYUCJS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)NC(=O)C2(CCCC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)