CAS 1024594-86-2 appears in our catalog under these names: 4,6-Dibromothieno(3,4-b)thiophene-2-carboxylic Acid, 4,6–Dibromothieno(3,4–b)thiophene–2–carboxylic acid, 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid, 97%, 97%, 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid, 95%, 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid, 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 750mg, 100mg, 1g, 500mg, 250mg.
4,6-dibromothieno[2,3-c]thiophene-2-carboxylic acid (CAS 1024594-86-2) is a chemical compound with the molecular formula C7H2Br2O2S2 and a molecular weight of 342.0 g/mol. IUPAC name: 4,6-dibromothieno[2,3-c]thiophene-2-carboxylic acid. InChIKey: LZZZIBXZKLAXSO-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2O2S2 |
|---|---|
| Molecular weight | 342.0 g/mol |
| IUPAC name | 4,6-dibromothieno[2,3-c]thiophene-2-carboxylic acid |
| InChIKey | LZZZIBXZKLAXSO-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C(SC(=C21)Br)Br)C(=O)O |
Computed by PubChem (NCBI)