Products 1024732-38-4
CAS 1024732-38-4 is the registry number for 2-acetyl-3-((2,4-difluorophenyl)amino)-N-phenylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxy-N-phenylbut-2-enamide (CAS 1024732-38-4) is a chemical compound with the molecular formula C17H14F2N2O2 and a molecular weight of 316.30 g/mol. IUPAC name: 2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxy-N-phenylbut-2-enamide. InChIKey: GCGFZZVPGMJAEK-UHFFFAOYSA-N.
| Molecular formula | C17H14F2N2O2 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | 2-[(2,4-difluorophenyl)iminomethyl]-3-hydroxy-N-phenylbut-2-enamide |
| InChIKey | GCGFZZVPGMJAEK-UHFFFAOYSA-N |
| SMILES | CC(=C(C=NC1=C(C=C(C=C1)F)F)C(=O)NC2=CC=CC=C2)O |
Computed by PubChem (NCBI)