CAS 1025127-41-6 is the registry number for 3-Amino-4-fluoro-5-hydroxybenzoic Acid. Offered by: TRC. Available pack sizes: 500mg.
3-amino-4-fluoro-5-hydroxybenzoic acid (CAS 1025127-41-6) is a chemical compound with the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. IUPAC name: 3-amino-4-fluoro-5-hydroxybenzoic acid. InChIKey: DHKZUTGJFRVSSV-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO3 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | 3-amino-4-fluoro-5-hydroxybenzoic acid |
| InChIKey | DHKZUTGJFRVSSV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)F)O)C(=O)O |
Computed by PubChem (NCBI)