CAS 1025135-08-3 is the registry number for 3-((3,5-dichlorophenyl)amino)-2-(phenylsulfonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-2-(benzenesulfonyl)-3-(3,5-dichloroanilino)prop-2-enenitrile (CAS 1025135-08-3) is a chemical compound with the molecular formula C15H10Cl2N2O2S and a molecular weight of 353.2 g/mol. IUPAC name: (E)-2-(benzenesulfonyl)-3-(3,5-dichloroanilino)prop-2-enenitrile. InChIKey: DTURWNBGAANTOO-XNTDXEJSSA-N.
| Molecular formula | C15H10Cl2N2O2S |
|---|---|
| Molecular weight | 353.2 g/mol |
| IUPAC name | (E)-2-(benzenesulfonyl)-3-(3,5-dichloroanilino)prop-2-enenitrile |
| InChIKey | DTURWNBGAANTOO-XNTDXEJSSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)/C(=C/NC2=CC(=CC(=C2)Cl)Cl)/C#N |
Computed by PubChem (NCBI)