Products 1025168-23-3
CAS 1025168-23-3 is the registry number for 2-(2,2-dimethylpropanoyl)-3-((4-methylphenyl)amino)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(2Z)-4,4-dimethyl-2-[(4-methylanilino)methylidene]-3-oxopentanenitrile (CAS 1025168-23-3) is a chemical compound with the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. IUPAC name: (2Z)-4,4-dimethyl-2-[(4-methylanilino)methylidene]-3-oxopentanenitrile. InChIKey: DCLZIVKAVBRGMV-BENRWUELSA-N.
| Molecular formula | C15H18N2O |
|---|---|
| Molecular weight | 242.32 g/mol |
| IUPAC name | (2Z)-4,4-dimethyl-2-[(4-methylanilino)methylidene]-3-oxopentanenitrile |
| InChIKey | DCLZIVKAVBRGMV-BENRWUELSA-N |
| SMILES | CC1=CC=C(C=C1)N/C=C(/C#N)\C(=O)C(C)(C)C |
Computed by PubChem (NCBI)