CAS 10252-29-6 appears in our catalog under these names: 4,4'-Azodibenzoyl dichloride, 95%, Azobenzene-4,4'-dicarbonyl Dichloride, Azobenzene-4,4'-dicarbonyl Dichloride, 98% T, Azobenzene–4,4'–dicarbonyl Dichloride, Azobenzene-4,4'-dicarbonyl Dichloride, >98.0%(T). Offered by: Combi-blocks, TRC, AmBeed, GLPBio, TCI. Available pack sizes: 250mg, 5g, 1g, 100mg, 10mg, 50mg.
4-[(4-carbonochloridoylphenyl)diazenyl]benzoyl chloride (CAS 10252-29-6) is a chemical compound with the molecular formula C14H8Cl2N2O2 and a molecular weight of 307.1 g/mol. IUPAC name: 4-[(4-carbonochloridoylphenyl)diazenyl]benzoyl chloride. InChIKey: ASOXKYGOZZTVHL-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2O2 |
|---|---|
| Molecular weight | 307.1 g/mol |
| IUPAC name | 4-[(4-carbonochloridoylphenyl)diazenyl]benzoyl chloride |
| InChIKey | ASOXKYGOZZTVHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)N=NC2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)