CAS 1025257-06-0 is the registry number for 2-acetyl-N-phenyl-3-((3-(trifluoromethyl)phenyl)amino)prop-2-enamide. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
3-hydroxy-N-phenyl-2-[[3-(trifluoromethyl)phenyl]iminomethyl]but-2-enamide (CAS 1025257-06-0) is a chemical compound with the molecular formula C18H15F3N2O2 and a molecular weight of 348.3 g/mol. IUPAC name: 3-hydroxy-N-phenyl-2-[[3-(trifluoromethyl)phenyl]iminomethyl]but-2-enamide. InChIKey: BHAHIQQXOFJEKR-UHFFFAOYSA-N.
| Molecular formula | C18H15F3N2O2 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 3-hydroxy-N-phenyl-2-[[3-(trifluoromethyl)phenyl]iminomethyl]but-2-enamide |
| InChIKey | BHAHIQQXOFJEKR-UHFFFAOYSA-N |
| SMILES | CC(=C(C=NC1=CC=CC(=C1)C(F)(F)F)C(=O)NC2=CC=CC=C2)O |
Computed by PubChem (NCBI)