CAS 1025258-26-7 is the registry number for amino((1-aza-2-(2-(4-bromophenoxy)-5-nitrophenyl)vinyl)amino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
[(E)-[2-(4-bromophenoxy)-5-nitrophenyl]methylideneamino]thiourea (CAS 1025258-26-7) is a chemical compound with the molecular formula C14H11BrN4O3S and a molecular weight of 395.23 g/mol. IUPAC name: [(E)-[2-(4-bromophenoxy)-5-nitrophenyl]methylideneamino]thiourea. InChIKey: GMGJZIMENMRIKX-CAOOACKPSA-N.
| Molecular formula | C14H11BrN4O3S |
|---|---|
| Molecular weight | 395.23 g/mol |
| IUPAC name | [(E)-[2-(4-bromophenoxy)-5-nitrophenyl]methylideneamino]thiourea |
| InChIKey | GMGJZIMENMRIKX-CAOOACKPSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2)[N+](=O)[O-])/C=N/NC(=S)N)Br |
Computed by PubChem (NCBI)