CAS 1025268-74-9 is the registry number for N-(4-methylthio(3H-2,3,5-triazolyl))-3-phenylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg.
(E)-N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-3-phenylprop-2-enamide (CAS 1025268-74-9) is a chemical compound with the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. IUPAC name: (E)-N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-3-phenylprop-2-enamide. InChIKey: FOHNKYHXLLDUFT-BQYQJAHWSA-N.
| Molecular formula | C12H12N4OS |
|---|---|
| Molecular weight | 260.32 g/mol |
| IUPAC name | (E)-N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-3-phenylprop-2-enamide |
| InChIKey | FOHNKYHXLLDUFT-BQYQJAHWSA-N |
| SMILES | CSC1=NNC(=N1)NC(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)