Products 1025294-19-2
CAS 1025294-19-2 is the registry number for ethyl 2-acetyl-3-((4-hydroxyphenyl)amino)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (E)-3-hydroxy-2-[(4-hydroxyphenyl)iminomethyl]but-2-enoate (CAS 1025294-19-2) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: ethyl (E)-3-hydroxy-2-[(4-hydroxyphenyl)iminomethyl]but-2-enoate. InChIKey: VQTGTMFJJJMLPP-LAHWPWFUSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | ethyl (E)-3-hydroxy-2-[(4-hydroxyphenyl)iminomethyl]but-2-enoate |
| InChIKey | VQTGTMFJJJMLPP-LAHWPWFUSA-N |
| SMILES | CCOC(=O)/C(=C(\C)/O)/C=NC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)