Products 1025302-40-2
CAS 1025302-40-2 is the registry number for methyl 3-((3-oxo-2-(N-phenylcarbamoyl)but-1-enyl)amino)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl 3-[[3-hydroxy-2-(phenylcarbamoyl)but-2-enylidene]amino]thiophene-2-carboxylate (CAS 1025302-40-2) is a chemical compound with the molecular formula C17H16N2O4S and a molecular weight of 344.4 g/mol. IUPAC name: methyl 3-[[3-hydroxy-2-(phenylcarbamoyl)but-2-enylidene]amino]thiophene-2-carboxylate. InChIKey: NRRANQSVOBXUBY-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O4S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | methyl 3-[[3-hydroxy-2-(phenylcarbamoyl)but-2-enylidene]amino]thiophene-2-carboxylate |
| InChIKey | NRRANQSVOBXUBY-UHFFFAOYSA-N |
| SMILES | CC(=C(C=NC1=C(SC=C1)C(=O)OC)C(=O)NC2=CC=CC=C2)O |
Computed by PubChem (NCBI)