Products 1025448-40-1
CAS 1025448-40-1 is the registry number for 2-Amino-2-(3,4-difluorophenyl)-N-methylacetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-2-(3,4-difluorophenyl)-N-methylacetamide (CAS 1025448-40-1) is a chemical compound with the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. IUPAC name: 2-amino-2-(3,4-difluorophenyl)-N-methylacetamide. InChIKey: HBKHJQUVEZXQFR-UHFFFAOYSA-N.
| Molecular formula | C9H10F2N2O |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 2-amino-2-(3,4-difluorophenyl)-N-methylacetamide |
| InChIKey | HBKHJQUVEZXQFR-UHFFFAOYSA-N |
| SMILES | CNC(=O)C(C1=CC(=C(C=C1)F)F)N |
Computed by PubChem (NCBI)