Products 1025530-12-4
CAS 1025530-12-4 is the registry number for 2-amino-1-(1-aza-2-(4-phenoxyphenyl)prop-1-enyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-2-amino-3-[1-(4-phenoxyphenyl)ethylideneamino]but-2-enedinitrile (CAS 1025530-12-4) is a chemical compound with the molecular formula C18H14N4O and a molecular weight of 302.3 g/mol. IUPAC name: (Z)-2-amino-3-[1-(4-phenoxyphenyl)ethylideneamino]but-2-enedinitrile. InChIKey: BICZMWDPGWIUQC-DGVOEJPESA-N.
| Molecular formula | C18H14N4O |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | (Z)-2-amino-3-[1-(4-phenoxyphenyl)ethylideneamino]but-2-enedinitrile |
| InChIKey | BICZMWDPGWIUQC-DGVOEJPESA-N |
| SMILES | CC(=N/C(=C(/C#N)\N)/C#N)C1=CC=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)