CAS 10256-24-3 appears in our catalog under these names: (2S,3R,4S,5R)-2-(2-Nitrophenoxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 95+%, 2’-Nitrophenyl 2,3,4-Tri-O-acetyl-Beta-D-xylopyranoside, >95% (HPLC), 2-Nitrophenyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg.
[(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-nitrophenoxy)oxan-3-yl] acetate (CAS 10256-24-3) is a chemical compound with the molecular formula C17H19NO10 and a molecular weight of 397.3 g/mol. IUPAC name: [(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-nitrophenoxy)oxan-3-yl] acetate. InChIKey: RSBQRDKQQIICFV-TWMKSMIVSA-N.
| Molecular formula | C17H19NO10 |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-nitrophenoxy)oxan-3-yl] acetate |
| InChIKey | RSBQRDKQQIICFV-TWMKSMIVSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)