Products 10256-43-6

CAS 10256-43-6 is the registry number for Ethanaminium,2-amino-N,N,N-trimethyl-, chloride (1:1), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-aminoethyl(trimethyl)azanium chloride (CAS 10256-43-6) is a chemical compound with the molecular formula C5H15ClN2 and a molecular weight of 138.64 g/mol. IUPAC name: 2-aminoethyl(trimethyl)azanium chloride. InChIKey: VSZWLDAGOXQHNB-UHFFFAOYSA-M.

Identity
Molecular formulaC5H15ClN2
Molecular weight138.64 g/mol
IUPAC name2-aminoethyl(trimethyl)azanium chloride
InChIKeyVSZWLDAGOXQHNB-UHFFFAOYSA-M
SMILESC[N+](C)(C)CCN.[Cl-]

Computed by PubChem (NCBI)