CAS 1025677-93-3 is the registry number for 3-(tert-butyl)-1-methylindeno(2,3-d)pyrazol-4-O-ethyloxime. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-3-tert-butyl-N-ethoxy-1-methylindeno[2,1-d]pyrazol-4-imine (CAS 1025677-93-3) is a chemical compound with the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. IUPAC name: (Z)-3-tert-butyl-N-ethoxy-1-methylindeno[2,1-d]pyrazol-4-imine. InChIKey: IIYWDGAWYLETGE-RGEXLXHISA-N.
| Molecular formula | C17H21N3O |
|---|---|
| Molecular weight | 283.37 g/mol |
| IUPAC name | (Z)-3-tert-butyl-N-ethoxy-1-methylindeno[2,1-d]pyrazol-4-imine |
| InChIKey | IIYWDGAWYLETGE-RGEXLXHISA-N |
| SMILES | CCO/N=C\1/C2=CC=CC=C2C3=C1C(=NN3C)C(C)(C)C |
Computed by PubChem (NCBI)