CAS 1025680-23-2 is the registry number for 2-(2H-2,3,4,5-tetraazolyl)-3-((4-ethoxyphenyl)amino)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-3-(4-ethoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (CAS 1025680-23-2) is a chemical compound with the molecular formula C12H12N6O and a molecular weight of 256.26 g/mol. IUPAC name: (E)-3-(4-ethoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile. InChIKey: UPDZVRGNNPDFOW-CMDGGOBGSA-N.
| Molecular formula | C12H12N6O |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | (E)-3-(4-ethoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| InChIKey | UPDZVRGNNPDFOW-CMDGGOBGSA-N |
| SMILES | CCOC1=CC=C(C=C1)N/C=C(\C#N)/C2=NNN=N2 |
Computed by PubChem (NCBI)