Products 1025716-81-7
CAS 1025716-81-7 is the registry number for MMP408, 99.81%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 5 mg, 50 mg, 10 mg, 10mM/1mL.
(2S)-2-[[8-(methoxycarbonylamino)dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoic acid (CAS 1025716-81-7) is a chemical compound with the molecular formula C19H20N2O7S and a molecular weight of 420.4 g/mol. IUPAC name: (2S)-2-[[8-(methoxycarbonylamino)dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoic acid. InChIKey: MKAIHDAGQJQAHA-KRWDZBQOSA-N.
| Molecular formula | C19H20N2O7S |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | (2S)-2-[[8-(methoxycarbonylamino)dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoic acid |
| InChIKey | MKAIHDAGQJQAHA-KRWDZBQOSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NS(=O)(=O)C1=CC2=C(C=C1)C3=C(O2)C=CC(=C3)NC(=O)OC |
Computed by PubChem (NCBI)