Products 1025721-10-1

CAS 1025721-10-1 is the registry number for 1-(4-Fluorophenyl)-4-iodo-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(4-fluorophenyl)-4-iodo-2-oxopyridine-3-carboxylic acid (CAS 1025721-10-1) is a chemical compound with the molecular formula C12H7FINO3 and a molecular weight of 359.09 g/mol. IUPAC name: 1-(4-fluorophenyl)-4-iodo-2-oxopyridine-3-carboxylic acid. InChIKey: CGDDRASYDFHWHN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7FINO3
Molecular weight359.09 g/mol
IUPAC name1-(4-fluorophenyl)-4-iodo-2-oxopyridine-3-carboxylic acid
InChIKeyCGDDRASYDFHWHN-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N2C=CC(=C(C2=O)C(=O)O)I)F

Computed by PubChem (NCBI)