CAS 1025721-10-1 is the registry number for 1-(4-Fluorophenyl)-4-iodo-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
1-(4-fluorophenyl)-4-iodo-2-oxopyridine-3-carboxylic acid (CAS 1025721-10-1) is a chemical compound with the molecular formula C12H7FINO3 and a molecular weight of 359.09 g/mol. IUPAC name: 1-(4-fluorophenyl)-4-iodo-2-oxopyridine-3-carboxylic acid. InChIKey: CGDDRASYDFHWHN-UHFFFAOYSA-N.
| Molecular formula | C12H7FINO3 |
|---|---|
| Molecular weight | 359.09 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-4-iodo-2-oxopyridine-3-carboxylic acid |
| InChIKey | CGDDRASYDFHWHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=CC(=C(C2=O)C(=O)O)I)F |
Computed by PubChem (NCBI)