CAS 10258-49-8 is the registry number for 1-Iodo-1h,1h-perfluorooctane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-iodooctane (CAS 10258-49-8) is a chemical compound with the molecular formula C8H2F15I and a molecular weight of 509.98 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-iodooctane. InChIKey: CVJNJHVXFLKZGB-UHFFFAOYSA-N.
| Molecular formula | C8H2F15I |
|---|---|
| Molecular weight | 509.98 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-iodooctane |
| InChIKey | CVJNJHVXFLKZGB-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)I |
Computed by PubChem (NCBI)